CymitQuimica logo

CAS 36405-01-3

:

5-amino-2-methyl-1,3-thiazole-4-carboxylic acid

Description:
5-Amino-2-methyl-1,3-thiazole-4-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its polar nature and potential for hydrogen bonding. The presence of the methyl group at the second position of the thiazole ring influences its solubility and reactivity. It is typically a crystalline solid, and its properties make it relevant in various fields, including pharmaceuticals and biochemistry, where it may serve as an intermediate in the synthesis of biologically active compounds. The compound's structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, its CAS number, 36405-01-3, provides a unique identifier for regulatory and research purposes. Overall, 5-amino-2-methyl-1,3-thiazole-4-carboxylic acid is notable for its functional groups and heterocyclic structure, which contribute to its chemical behavior and applications.
Formula:C5H6N2O2S
InChI:InChI=1/C5H6N2O2S/c1-2-7-3(5(8)9)4(6)10-2/h6H2,1H3,(H,8,9)
InChI key:USZABUOLFPZBEV-UHFFFAOYSA-N
SMILES:Cc1nc(c(N)s1)C(=O)O
Synonyms:
  • 4-Thiazolecarboxylic acid, 5-amino-2-methyl-
Found 4 products.