CAS 364077-84-9
:BOC-4-OXO-PRO-OME
Description:
BOC-4-OXO-PRO-OME, with the CAS number 364077-84-9, is a chemical compound that features a tert-butyloxycarbonyl (BOC) protecting group, which is commonly used in organic synthesis to protect amines during chemical reactions. The "4-OXO" indicates the presence of a ketone functional group at the fourth position of the proline structure, suggesting that it is a derivative of proline, an amino acid. The "OME" likely refers to a methoxy group, which can influence the compound's reactivity and solubility. This compound is typically utilized in peptide synthesis and other organic transformations, where the BOC group can be removed under acidic conditions to reveal the free amine. Its characteristics include moderate stability under standard laboratory conditions, solubility in organic solvents, and potential reactivity due to the presence of the ketone and methoxy groups. Overall, BOC-4-OXO-PRO-OME serves as a valuable intermediate in the synthesis of more complex molecules in medicinal chemistry and biochemistry.
Formula:C11H17NO5
InChI:InChI=1/C11H17NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h8H,5-6H2,1-4H3/t8-/m0/s1
SMILES:CC(C)(C)OC(=O)N1CC(=O)C[C@H]1C(=O)OC
Synonyms:- Boc-Pro-(4-Keto)-Ome
- Boc-4-Oxo-L-Proline Methyl Ester
- Boc-Gamma-Keto-L-Proline Methyl Ester
- Boc-L-Pro(4-O)-Ome
- Boc-L-Pro(4-Oxo)-Ome
- (S)-N-Alpha-Tert-Butyloxycarbonyl-4-Oxo-Proline Methyl Ester
- N-T-Boc-4-Oxo-L-Proline Methyl Ester
- N-Boc-4-oxo-L-proline methyl ester
- 1-tert-butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
- Boc-4-oxo-D-proline methyl ester
- 1-Tert-Butyl 2-Methyl (2R)-4-Oxopyrrolidine-1,2-Dicarboxylate
- (R)-1-(tert-butoxycarbonyl)-4-oxoyrrolidine-2-carboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Pyrrolidinedicarboxylic acid, 4-oxo-, 1-(1,1-dimethylethyl) ester,(2R)-
CAS:Formula:C10H15NO5Purity:96%Color and Shape:SolidMolecular weight:229.2298Ref: IN-DA00I77T
250gTo inquire500gTo inquire100mg27.00€250mg33.00€500mg57.00€1g58.00€5g114.00€10g166.00€(R)-1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid
CAS:(R)-1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acidPurity:97%Molecular weight:229.23g/mol(R)-1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid
CAS:Formula:C10H15NO5Purity:96%Color and Shape:No data available.Molecular weight:229.232(R)-1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid
CAS:Versatile small molecule scaffoldFormula:C10H15NO5Purity:Min. 95%Molecular weight:229.23 g/mol



