CAS 36417-86-4: Paprazine
Description:Paprazine, identified by its CAS number 36417-86-4, is a chemical compound that belongs to the class of piperazine derivatives. It is characterized by its molecular structure, which typically includes a piperazine ring, contributing to its pharmacological properties. Paprazine is known for its potential applications in medicinal chemistry, particularly as an anti-parasitic agent. Its mechanism of action often involves interference with the biological processes of target organisms, making it useful in treating certain infections. The compound may exhibit varying solubility in different solvents, influencing its bioavailability and efficacy. Additionally, like many chemical substances, Paprazine's safety profile, including toxicity and side effects, is an important consideration in its application. Overall, Paprazine represents a significant compound in the realm of pharmaceuticals, with ongoing research aimed at exploring its full potential and optimizing its use in therapeutic contexts.
Formula:C17H17NO3
InChI:InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+
InChI key:InChIKey=RXGUTQNKCXHALN-BJMVGYQFSA-N
SMILES:O=C(C=CC1=CC=C(O)C=C1)NCCC2=CC=C(O)C=C2
- Synonyms:
- 2-Propenamide, 3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (E)-
- N-(p-Hydroxy-β-phenylethyl)-p-hydroxy-trans-cinnamamide
- (2E)-3-(4-Hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-2-propenamide
- 2-Propenamide, 3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (2E)-
- trans-N-(p-Coumaroyl)tyramine
