CAS 3643-16-1

Spiro[4.5]decan-2-one

Description:

Spiro[4.5]decan-2-one is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a ketone functional group at the second position of the decanone framework, contributing to its reactivity and potential applications in organic synthesis. The molecular formula of Spiro[4.5]decan-2-one indicates that it contains a total of ten carbon atoms, along with hydrogen and oxygen atoms, which are typical for ketones. Its spiro configuration imparts distinctive stereochemical properties, influencing its physical and chemical behavior. The compound is generally colorless to pale yellow and may exhibit a characteristic odor. Due to its structural features, Spiro[4.5]decan-2-one can participate in various chemical reactions, making it of interest in fields such as medicinal chemistry and materials science. However, specific handling and safety measures should be observed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.

Formula: C₁₀H₁₆O

InChI: InChI=1/C10H16O/c11-9-4-7-10(8-9)5-2-1-3-6-10/h1-8H2

InChI key: InChIKey=DJHRXBYWKVQDJY-UHFFFAOYSA-N

SMILES: O=C1CC2(CC1)CCCCC2

Synonyms:

• Spiro[4.5]decan-2-one

Spiro[4.5]decan-2-one

CAS: 3643-16-1

Spiro[4.5]decan-2-one is a lactam that is used in pharmaceutical formulations for the treatment of cerebral and nervous disorders. Lactams are prepared by reacting an amine with a carbonyl compound, usually a carboxylic acid, in the presence of an acid catalyst. This reaction creates a ring structure that contains both a nitrogen atom and an oxygen atom. Spiro[4.5]decan-2-one can be administered orally or intravenously. It is also used as an intermediate in the synthesis of other drugs, such as anti-inflammatory agents and antibiotics. The preparation process includes three steps: the tosylate is activated by reaction with hydrochloric acid; then it reacts with magnesium sulfate to form the crystalline salt; and finally this salt is treated with ethyl chloride to produce the hydrochloride salt, which is soluble in water.

Formula: C₁₀H₁₆O

Purity: Min. 95%

Molecular weight: 152.23 g/mol

Ref: 3D-DAA64316