CAS 36431-82-0
:2-(1-phenylcyclohexyl)-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone - L-threo-hex-1-enofuranos-3-ulose (1:1)
Description:
The chemical substance known as "2-(1-phenylcyclohexyl)-1-[4-(2-phenylethyl)piperazin-1-yl]ethanone - L-threo-hex-1-enofuranos-3-ulose (1:1)" with CAS number 36431-82-0 is a complex organic compound that features multiple functional groups and structural motifs. It contains a phenylcyclohexyl moiety, which is often associated with psychoactive properties, and a piperazine ring that can influence its pharmacological activity. The presence of an ethanone group suggests potential reactivity typical of ketones, while the furanoside structure indicates it may exhibit properties related to sugars or glycosides. This compound's stereochemistry, denoted by "L-threo," implies specific spatial arrangements that can significantly affect its biological interactions and activity. The 1:1 designation indicates a specific stoichiometric relationship, possibly in a salt or complex form. Overall, this substance may have implications in medicinal chemistry, particularly in the development of therapeutic agents, but detailed studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C32H42N2O7
InChI:InChI=1/C26H34N2O.C6H8O6/c29-25(22-26(15-8-3-9-16-26)24-12-6-2-7-13-24)28-20-18-27(19-21-28)17-14-23-10-4-1-5-11-23;7-1-2(8)5-3(9)4(10)6(11)12-5/h1-2,4-7,10-13H,3,8-9,14-22H2;2,5,7-8,10-11H,1H2/t;2-,5+/m.0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Ascorbic acid
CAS:<p>Ascorbic acid is an essential vitamin, also known as Vitamin C, which is a naturally occurring organic compound abundant in various fruits and vegetables, including citrus fruits, berries, and peppers. Its mode of action primarily relies on its ability to donate electrons, thereby neutralizing free radicals and reducing oxidative stress at the cellular level. Furthermore, ascorbic acid acts as a cofactor for several vital enzymatic reactions, including collagen synthesis, iron absorption, and the biosynthesis of neurotransmitters.</p>Formula:C32H42N2O7Purity:Min. 95%Molecular weight:566.69 g/mol
