CAS 36437-22-6

L-Arabinose, (aminothioxomethyl)hydrazone

Description:

L-Arabinose, (aminothioxomethyl)hydrazone is a chemical compound characterized by its unique structural features, which include a hydrazone functional group and a thioxomethyl moiety. This compound is derived from L-arabinose, a five-carbon aldopentose sugar, through a condensation reaction with an aminothioxomethyl group. The presence of the hydrazone linkage imparts specific reactivity, making it useful in various chemical applications, including potential roles in organic synthesis and as a building block in medicinal chemistry. The thioxomethyl group may contribute to the compound's biological activity, potentially influencing its interaction with biological targets. L-Arabinose itself is known for its role in carbohydrate metabolism and can be utilized in various biochemical applications. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the surrounding functional groups and the overall molecular structure. As with many hydrazones, it may exhibit tautomerism and can participate in various chemical reactions, including condensation and oxidation processes.

Formula: C₆H₁₃N₃O₄S

InChI: InChI=1S/C6H13N3O4S/c7-6(14)9-8-1-3(11)5(13)4(12)2-10/h1,3-5,10-13H,2H2,(H3,7,9,14)/t3-,4-,5+/m0/s1

InChI key: InChIKey=WOOLWGHQYCIONW-VAYJURFESA-N

SMILES: [C@@H]([C@H](C=NNC(N)=S)O)([C@H](CO)O)O

Synonyms:

• <span class="text-smallcaps">L</span>-Arabinose, (aminothioxomethyl)hydrazone
• Arabinose, thiosemicarbazone
• Arabinose,thiosemicarbazone (7CI)
• L-Arabinose, (aminothioxomethyl)hydrazone

L-Arabinopyranosyl thiosemicarbazide

CAS: 36437-22-6

Ref: 7W-GC2460