CAS 3644-12-0
:N-(Methoxymethyl)-2-methyl-2-propenamide
Description:
N-(Methoxymethyl)-2-methyl-2-propenamide, with the CAS number 3644-12-0, is an organic compound characterized by its amide functional group and a methoxymethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It possesses a relatively low molecular weight and is soluble in organic solvents, which makes it useful in various chemical applications. The presence of the methoxymethyl group enhances its reactivity, allowing it to participate in various chemical reactions, including polymerization and cross-linking processes. Additionally, the compound may exhibit properties such as moderate volatility and stability under standard conditions, although it should be handled with care due to potential reactivity. Its applications can range from use in synthetic organic chemistry to potential roles in the production of polymers or as an intermediate in the synthesis of more complex molecules. As with all chemical substances, safety data sheets should be consulted for handling and storage guidelines.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-5(2)6(8)7-4-9-3/h1,4H2,2-3H3,(H,7,8)
InChI key:InChIKey=YOZHLACIXDCHPV-UHFFFAOYSA-N
SMILES:C(C(C)=C)(NCOC)=O
Synonyms:- 2-Propenamide, N-(methoxymethyl)-2-methyl-
- Acrylamide, N-(methoxymethyl)-2-methyl-
- Methoxymethylmethacrylamide
- N-(Methoxymethyl)-2-methyl-2-propenamide
- N-(Methoxymethyl)methacrylamide
- N-(methoxymethyl)-2-methylprop-2-enamide
- N-Methoxymethymethacrylamide
- N-Methylolmethacrylamide methyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(Methoxymethyl)methacrylamide (stabilized with MEHQ)
CAS:Formula:C6H11NO2Purity:>85.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:129.16N-(methoxymethyl)methacrylamide
CAS:Formula:C6H11NO2Purity:85%Color and Shape:LiquidMolecular weight:129.1570N-(Methoxymethyl)Methacrylamide
CAS:N-(Methoxymethyl)MethacrylamidePurity:85%,stabilized with MEHQMolecular weight:129.16g/molN-(Methoxymethyl)methacrylamide
CAS:N-(Methoxymethyl)methacrylamide (MMMA) is an analyte that can be monitored using electrospray ionization mass spectrometry. MMMA is a structural analog of acrylamide and reacts with formic acid to produce methacrylic acid. The reaction can be monitored by monitoring the loss of the methyl group from MMMA. The calibration curve for MMMA has been established at different temperatures, which allows for monitoring at different temperatures. This analyte can also be used in liquid chromatography with a structured column and elution times that are dependent on the structure of the compound being separated.Formula:C6H11NO2Purity:Min. 95%Molecular weight:129.16 g/mol



