CAS 36443-80-8
:1-Benzyl-3-methylimidazolium chloride
Description:
1-Benzyl-3-methylimidazolium chloride is an ionic liquid characterized by its unique structure, which includes a benzyl group and a methyl group attached to the imidazolium ring. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits low volatility, making it an attractive alternative to traditional organic solvents. It has a relatively high thermal stability and can remain stable over a wide temperature range. The presence of the imidazolium cation contributes to its ionic nature, which imparts distinctive properties such as high ionic conductivity and solvation capabilities. Additionally, 1-benzyl-3-methylimidazolium chloride is known for its ability to dissolve a variety of organic and inorganic compounds, making it useful in various applications, including catalysis, electrochemistry, and as a solvent in chemical reactions. Its hygroscopic nature means it can absorb moisture from the environment, which should be considered during storage and handling. Overall, this compound exemplifies the versatility and functionality of ionic liquids in modern chemistry.
Formula:C11H13ClN2
InChI:InChI=1/C11H13N2.ClH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;/h2-8,10H,9H2,1H3;1H/q+1;/p-1
Synonyms:- 1-benzyl-3-methyl-1H-imidazol-3-ium chloride
- 1-Benzyl-3-Methylimidazolium Bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Benzyl-3-methylimidazolium chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H13ClN2Purity:97%Molecular weight:208.691H-Imidazolium,1-methyl-3-(phenylmethyl)-, chloride (1:1)
CAS:Formula:C11H13ClN2Purity:97%Color and Shape:SolidMolecular weight:208.68731-Benzyl-3-methyl-1H-imidazol-3-ium chloride
CAS:1-Benzyl-3-methyl-1H-imidazol-3-ium chloridePurity:97%Molecular weight:208.69g/mol1-Benzyl-3-methylimidazolium Chloride
CAS:Formula:C11H13ClN2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:208.691-Benzyl-3-methyl-1H-imidazol-3-ium chloride
CAS:Formula:C11H13ClN2Purity:97%Color and Shape:SolidMolecular weight:208.69




