CymitQuimica logo

CAS 36443-80-8

:

1-Benzyl-3-methylimidazolium chloride

Description:
1-Benzyl-3-methylimidazolium chloride is an ionic liquid characterized by its unique structure, which includes a benzyl group and a methyl group attached to the imidazolium ring. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits low volatility, making it an attractive alternative to traditional organic solvents. It has a relatively high thermal stability and can remain stable over a wide temperature range. The presence of the imidazolium cation contributes to its ionic nature, which imparts distinctive properties such as high ionic conductivity and solvation capabilities. Additionally, 1-benzyl-3-methylimidazolium chloride is known for its ability to dissolve a variety of organic and inorganic compounds, making it useful in various applications, including catalysis, electrochemistry, and as a solvent in chemical reactions. Its hygroscopic nature means it can absorb moisture from the environment, which should be considered during storage and handling. Overall, this compound exemplifies the versatility and functionality of ionic liquids in modern chemistry.
Formula:C11H13ClN2
InChI:InChI=1/C11H13N2.ClH/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;/h2-8,10H,9H2,1H3;1H/q+1;/p-1
InChI key:FCRZSGZCOGHOGF-UHFFFAOYSA-M
SMILES:C[N+]1=CN(C=C1)CC2=CC=CC=C2.[Cl-]
Synonyms:
  • 1-benzyl-3-methyl-1H-imidazol-3-ium chloride
  • 1-Benzyl-3-Methylimidazolium Bromide
Found 6 products.