CAS 3646-68-2: D-Glucosaminic acid
Description:D-Glucosaminic acid, with the CAS number 3646-68-2, is an amino sugar derived from glucose. It is characterized by the presence of an amino group (-NH2) at the C2 position, which distinguishes it from its parent compound, glucose. This modification imparts unique biochemical properties, making D-glucosaminic acid an important component in various biological processes, particularly in the synthesis of glycoproteins and glycolipids. It plays a crucial role in the structure of chitin, a key structural polysaccharide found in the exoskeletons of arthropods and the cell walls of fungi. D-Glucosaminic acid is typically a white crystalline solid that is soluble in water, reflecting its polar nature due to the hydroxyl and amino groups. Its reactivity is influenced by the functional groups present, allowing it to participate in various chemical reactions, including acylation and amidation. Additionally, it has potential applications in pharmaceuticals and biotechnology, particularly in the development of drugs targeting metabolic disorders and in tissue engineering.
Formula:C6H13NO6
InChI:InChI=1S/C6H13NO6/c7-3(6(12)13)5(11)4(10)2(9)1-8/h2-5,8-11H,1,7H2,(H,12,13)/t2-,3-,4-,5-/m1/s1
InChI key:InChIKey=UFYKDFXCZBTLOO-TXICZTDVSA-N
SMILES:O=C(O)C(N)C(O)C(O)C(O)CO
- Synonyms:
- (3R,4S,5R)-3,4,5,6-tetrahydroxy-D-norleucine
- 2-Amino-2-deoxy-<span class="text-smallcaps">D</span>-gluconic acid
- 2-Amino-2-deoxy-D-gluconic acid
- 3,4,5,6-Tetrahydroxynorleucine
- <span class="text-smallcaps">D</span>-Gluconic acid, 2-amino-2-deoxy-
- <span class="text-smallcaps">D</span>-Glucosamic acid
- <span class="text-smallcaps">D</span>-Glucosaminic acid
- D-Glucosamic acid
- Gluconic acid, 2-amino-2-deoxy-, <span class="text-smallcaps">D</span>-
- Glucosamicacid, 98%
- See more synonyms
- Glucosaminic acid
- NSC 37779
- NSC 404265
- D-Gluconic acid, 2-amino-2-deoxy-
- D-Glucosaminic acid
- Gluconic acid, 2-amino-2-deoxy-, D-
