CAS 364622-33-3
:Lucidenic acid N
Description:
Lucidenic acid N, identified by its CAS number 364622-33-3, is a triterpenoid compound primarily derived from certain species of mushrooms, particularly those belonging to the Ganoderma genus. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Lucidenic acid N is noted for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities, making it a subject of interest in medicinal chemistry and natural product research. Its solubility profile typically indicates that it is more soluble in organic solvents than in water, which is common for many triterpenoids. Additionally, lucidenic acid N may exhibit various biological activities, contributing to the health benefits associated with the mushrooms from which it is extracted. Ongoing research aims to further elucidate its mechanisms of action and potential therapeutic applications.
Formula:C27H40O6
InChI:InChI=1S/C27H40O6/c1-14(7-8-21(32)33)15-11-20(31)27(6)23-16(28)12-18-24(2,3)19(30)9-10-25(18,4)22(23)17(29)13-26(15,27)5/h14-16,18-19,28,30H,7-13H2,1-6H3,(H,32,33)/t14-,15-,16+,18+,19+,25+,26-,27+/m1/s1
InChI key:InChIKey=YBGBNHHXOJXFNM-UQCMLMITSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](C[C@@H]3O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]
Synonyms:- (3β,5α,7β)-3,7-Dihydroxy-4,4,14-trimethyl-11,15-dioxochol-8-en-24-oic acid
- Chol-8-en-24-oic acid, 3,7-dihydroxy-4,4,14-trimethyl-11,15-dioxo-, (3β,5α,7β)-
- Lucidenic acid SP1
- Lucidenic acid N
- Lucidenic acid LM1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lucidenic acid LM1
CAS:Formula:C27H40O6Purity:≥ 98.0%Color and Shape:Off-white solidMolecular weight:460.61Lucidenic acid LM1
CAS:Lucidenic acid SP1 is a natural productFormula:C27H40O6Purity:98%Color and Shape:SolidMolecular weight:460.6Lucidenic acid N
CAS:Controlled ProductLucidenic acid N is a caffeic acid derivative that has anticomplement activity. It is found in the mushroom Ganoderma lucidum and has been shown to have biological properties. Lucidenic acid N has been shown to inhibit growth of some tumors, including those induced by carcinogens, and also blocks the development of allergic responses. Lucidenic acid N has been shown to reduce the glomerular filtration rate and urea nitrogen in rats given a high protein diet. This compound also inhibits proliferation of vascular smooth muscle cells and can promote angiogenesis by activating the epidermal growth factor receptor pathway.Purity:Min. 95%



