CymitQuimica logo

CAS 364631-72-1

:

Carbamic acid, [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-,1,1-dimethylethyl ester

Description:
Carbamic acid, [5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-, 1,1-dimethylethyl ester, identified by CAS number 364631-72-1, is an organic compound characterized by its carbamate functional group. This compound features a dioxane ring, which contributes to its cyclic structure, and includes hydroxymethyl and dimethyl substituents that enhance its steric properties. The presence of the carbamate moiety suggests potential applications in agriculture as a pesticide or herbicide, as carbamates are known for their biological activity. Additionally, the ester functionality may influence its solubility and reactivity, making it suitable for various chemical reactions. The compound's stability and reactivity can be affected by environmental factors, such as pH and temperature, which are important considerations for its practical applications. Overall, this compound exemplifies the complexity of organic molecules, combining elements of both cyclic and acyclic structures, and may have implications in medicinal chemistry or agrochemical development.
Formula:C12H23NO5
InChI:InChI=1S/C12H23NO5/c1-10(2,3)18-9(15)13-12(6-14)7-16-11(4,5)17-8-12/h14H,6-8H2,1-5H3,(H,13,15)
InChI key:UIDPKGWXTKYSPZ-UHFFFAOYSA-N
SMILES:CC1(OCC(CO1)(CO)NC(=O)OC(C)(C)C)C
Found 4 products.