CymitQuimica logo

CAS 364750-81-2

:

(2S,4S)-N-Boc-4-methylpyrrolidine-2-carboxylic acid

Description:
(2S,4S)-N-Boc-4-methylpyrrolidine-2-carboxylic acid is a chiral compound characterized by its pyrrolidine ring structure, which includes a tert-butyloxycarbonyl (Boc) protecting group at the nitrogen atom and a carboxylic acid functional group at the second carbon. This compound is notable for its stereochemistry, specifically the (2S,4S) configuration, which plays a crucial role in its biological activity and potential applications in pharmaceuticals. The presence of the methyl group at the fourth position contributes to its steric properties and can influence interactions with biological targets. As a carboxylic acid, it exhibits typical acidic behavior, including the ability to donate protons in solution. The Boc group serves as a protective moiety, allowing for selective reactions at other functional groups during synthetic processes. This compound is often utilized in the synthesis of peptides and other biologically active molecules, making it valuable in medicinal chemistry and drug development. Its unique structural features and stereochemistry make it a subject of interest in various chemical research fields.
Formula:C11H19NO4
InChI:InChI=1/C11H19NO4/c1-7-5-8(9(13)14)12(6-7)10(15)16-11(2,3)4/h7-8H,5-6H2,1-4H3,(H,13,14)/t7-,8-/m0/s1
InChI key:MXKSXPYZNXUHEZ-YUMQZZPRSA-N
SMILES:C[C@H]1C[C@@H](C(=O)O)N(C1)C(=O)OC(C)(C)C
Synonyms:
  • (2S,4S)-1-(tert-Butoxycarbonyl)-4-methylpyrrolidine-2-carboxylic acid
  • (2S,4S)-4-Methyl-1,2-pyrrolidinedicarboxylic acid 1-(1,1-dimethylethyl) ester
  • Boc-4-Me-Pro-OH
Found 4 products.