CAS 364793-52-2: 6-bromo-4-oxo-1,4-dihydroquinoline-3-carbonitrile

Description: 6-Bromo-4-oxo-1,4-dihydroquinoline-3-carbonitrile is a chemical compound characterized by its unique quinoline structure, which features a bromine atom at the 6-position and a carbonitrile group at the 3-position. This compound typically exhibits a yellow to orange color and is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the carbonitrile group contributes to its reactivity and potential interactions with biological targets. Additionally, the 4-oxo group indicates that it has a ketone functional group, which can influence its chemical behavior and solubility. The compound is likely to be soluble in organic solvents and may have limited solubility in water. Its molecular structure suggests that it could participate in various chemical reactions, making it of interest for synthetic applications. As with many heterocyclic compounds, it may also exhibit interesting properties such as fluorescence or photostability, depending on its specific environment and conditions.

Formula: C₁₀H₅BrN₂O

InChI: InChI=1/C10H5BrN2O/c11-7-1-2-9-8(3-7)10(14)6(4-12)5-13-9/h1-3,5H,(H,13,14)

Synonyms:

• 6-Brom-4-hydroxychinolin-3-carbonitril
• 6-Brom-4-oxo-1,4-dihydrochinolin-3-carbonitril
• 6-Bromo-4-Hydroxyquinoline-3-Carbonitrile

6-Bromo-4-hydroxyquinoline-3- carbonitrile

CAS: 364793-52-2

• Formula: C₁₀H₅FN₂O
• Molecular weight: 188.1579

6-Bromo-4-oxo-1,4-dihydroquinoline-3-carbonitrile

CAS: 364793-52-2

Versatile small molecule scaffold

• Formula: C₁₀H₅BrN₂O
• Purity: Min. 95%
• Molecular weight: 249.06 g/mol