CymitQuimica logo

CAS 364793-57-7

:

7-bromo-4-chloroquinoline-3-carbonitrile

Description:
7-Bromo-4-chloroquinoline-3-carbonitrile is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 7 and 4 positions, respectively, contributes to its unique chemical reactivity and potential biological activity. The carbonitrile functional group at the 3 position enhances its polarity and can influence its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Additionally, the presence of halogens may impart specific properties such as increased lipophilicity or altered electronic characteristics, which can be advantageous in drug design. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with halogenated compounds.
Formula:C10H4BrClN2
InChI:InChI=1/C10H4BrClN2/c11-7-1-2-8-9(3-7)14-5-6(4-13)10(8)12/h1-3,5H
InChI key:SIBDBTCUQDTNQN-UHFFFAOYSA-N
SMILES:c1cc2c(cc1Br)ncc(C#N)c2Cl
Synonyms:
  • 3-Quinolinecarbonitrile, 7-bromo-4-chloro-
  • 7-Brom-4-chlorchinolin-3-carbonitril
  • 7-Bromo-4-chloro-quinoline-3-carbonitrile
  • 7-bromo-4-chloro-3-Quinolinecarbonitrile
Found 2 products.