
CAS 364794-79-6
:4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]morpholine
Description:
4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]morpholine, with the CAS number 364794-79-6, is a chemical compound that features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound is characterized by the presence of a boron-containing moiety, specifically a dioxaborolane, which contributes to its potential applications in organic synthesis and medicinal chemistry. The tetramethyl groups enhance its stability and solubility, while the benzyl group provides additional functionalization. The morpholine structure imparts properties such as basicity and the ability to form hydrogen bonds, making it useful in various chemical reactions. This compound may exhibit interesting biological activities due to its unique structural features, which can influence its interaction with biological targets. Overall, its combination of a morpholine core and a boron-containing substituent suggests potential utility in drug development and material science, particularly in the context of boron chemistry and its applications in pharmaceuticals.
Formula:C17H26BNO3
InChI:InChI=1/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)15-7-5-14(6-8-15)13-19-9-11-20-12-10-19/h5-8H,9-13H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2)CN2CCOCC2)O1
Synonyms:- 4-(4-Methylmorpholine)benzeneboronic acid pinacol ester
- Morpholine, 4-[[4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Phenyl]Methyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Morpholinomethyl)phenylboronic acid, pinacol ester
CAS:Formula:C17H26BNO3Purity:95%Color and Shape:SolidMolecular weight:303.20424-[(Morpholin-4-yl)methyl]benzeneboronic acid, pinacol ester
CAS:4-[(Morpholin-4-yl)methyl]benzeneboronic acid, pinacol esterFormula:C17H26BNO3Purity:98%Color and Shape: white solidMolecular weight:303.20g/mol4-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]morpholine
CAS:Formula:C17H26BNO3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:303.214-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]morpholine
CAS:Formula:C17H26BNO3Purity:95%Color and Shape:Solid, White powderMolecular weight:303.214-(4-Morpholinomethyl)phenylboronic acid pinacol ester
CAS:4-(4-Morpholinomethyl)phenylboronic acid pinacol ester is a synthetic chemical that is used in industrial synthesis. It can be synthesized from bromobenzoate and pinacol in high yield under mild reaction conditions. 4-(4-Morpholinomethyl)phenylboronic acid pinacol ester has been shown to be stable in the environment and does not react with other chemicals. The compound is used in the production of pharmaceuticals, plastics, pesticides, and herbicides.Formula:C17H26BNO3Purity:Min. 95%Molecular weight:303.2 g/mol




