CAS 3650-28-0
:(+)-sativen
Description:
(+)-Sativene, with the CAS number 3650-28-0, is a naturally occurring organic compound classified as a sesquiterpene. It is characterized by its unique bicyclic structure, which contributes to its distinct chemical properties and biological activities. This compound is typically found in various plant species and is known for its potential applications in the fields of perfumery and flavoring due to its aromatic qualities. (+)-Sativene exhibits a specific optical rotation, indicating its chiral nature, which is common among many terpenes. Additionally, it may possess antimicrobial and antifungal properties, making it of interest in pharmacological research. The compound's volatility and solubility in organic solvents are typical of sesquiterpenes, allowing for its extraction and utilization in various formulations. Overall, (+)-sativene represents a fascinating subject of study within the realm of natural products and their applications in industry and medicine.
Formula:C15H24
InChI:InChI=1/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m0/s1
Synonyms:- (+)-Sativene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Sativene
CAS:(+)-Sativene is a sesquiterpene compound, which is a type of naturally occurring hydrocarbon. It is derived from various plant sources, including certain species of the Cannabis genus and other aromatic plants. As a member of the terpenoid family, (+)-Sativene is characterized by its distinctive hydrocarbon structure, contributing to its presence in essential oils and its role in natural plant fragrances.Formula:C10H9ClN2Purity:Min. 95%Molecular weight:192.64 g/mol

