CymitQuimica logo

CAS 3650-78-0

:

methyl 3-(4-bromophenyl)acrylate

Description:
Methyl 3-(4-bromophenyl)acrylate is an organic compound characterized by its acrylate functional group, which contributes to its reactivity and utility in various chemical applications. It features a methyl ester group, enhancing its solubility in organic solvents. The presence of the 4-bromophenyl substituent introduces both electron-withdrawing and steric effects, influencing its reactivity and potential applications in synthesis. This compound typically appears as a colorless to pale yellow liquid and has a distinct aromatic odor. It is known for its role in organic synthesis, particularly in the preparation of polymers and other complex molecules through reactions such as polymerization and cross-coupling. Methyl 3-(4-bromophenyl)acrylate is also of interest in medicinal chemistry for its potential biological activities. As with many organic compounds, it should be handled with care, observing appropriate safety protocols due to its chemical reactivity and potential toxicity.
Formula:C10H9BrO2
InChI:InChI=1/C10H9BrO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+
InChI key:MFKOGXVHZUSUAF-QPJJXVBHSA-N
SMILES:COC(=O)/C=C/C1=CC=C(C=C1)Br
Synonyms:
  • Methyl 3-(4-Bromophenyl)Prop-2-Enoate
  • methyl (2E)-3-(4-bromophenyl)prop-2-enoate
Found 4 products.