CAS 36519-16-1
:7-pentofuranosyl-1,7-dihydro-4H-imidazo[4,5-d][1,2,3]triazin-4-one
Description:
7-Pentofuranosyl-1,7-dihydro-4H-imidazo[4,5-d][1,2,3]triazin-4-one is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazo[4,5-d]triazin core fused with a pentofuranosyl moiety. This compound is notable for its potential biological activity, particularly in the context of nucleoside analogs, which can influence nucleic acid metabolism. The presence of the furanosyl group suggests that it may interact with nucleic acids or enzymes involved in nucleic acid synthesis or repair. Its structure includes multiple nitrogen atoms, contributing to its basicity and potential interactions with biological targets. The compound may exhibit properties such as solubility in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the imidazo[4,5-d]triazin framework is often associated with pharmacological activity, making this compound of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific biological functions and potential applications.
Formula:C9H11N5O5
InChI:InChI=1/C9H11N5O5/c15-1-3-5(16)6(17)9(19-3)14-2-10-4-7(14)11-13-12-8(4)18/h2-3,5-6,9,15-17H,1H2,(H,11,12,18)
SMILES:C(C1C(C(C(n2cnc3c2nnnc3O)O1)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Azainosine
CAS:2-Azainosine is a medicinal compound that has been shown to have potent anticancer properties. It is an analog of inosine and acts as an inhibitor of kinase, which is involved in the regulation of cell cycle and apoptosis. 2-Azainosine has been found to inhibit the growth of various cancer cells, including those from human lung cancer and Chinese hamster ovary tumors. This compound has also been detected in human urine, indicating its potential for use as a diagnostic tool for cancer. 2-Azainosine works by blocking protein synthesis, leading to cell death and preventing tumor growth. As a promising anticancer agent, it holds great potential for the development of new cancer treatments.
Formula:C9H11N5O5Purity:Min. 95%Molecular weight:269.21 g/mol

