CAS 3652-90-2
:2-Bromocarbazole
Description:
2-Bromocarbazole is an organic compound characterized by its structure, which consists of a carbazole core substituted with a bromine atom at the second position. It is a member of the carbazole family, which is known for its aromatic properties and potential applications in organic electronics, such as light-emitting diodes and solar cells. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including cross-coupling reactions and as a building block for synthesizing more complex molecules. 2-Bromocarbazole typically exhibits moderate solubility in organic solvents and has a relatively high melting point, indicative of its stable aromatic structure. Its chemical properties allow it to participate in electrophilic substitution reactions, and it can also act as a ligand in coordination chemistry. Additionally, due to its potential biological activity, it may be of interest in medicinal chemistry. Overall, 2-Bromocarbazole serves as a versatile compound in both synthetic and applied chemistry contexts.
Formula:C12H8BrN
InChI:InChI=1S/C12H8BrN/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7,14H
InChI key:InChIKey=PJRGCJBBXGNEGD-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(C=3C(N2)=CC=CC3)=CC1
Synonyms:- 2-Bromocarbazole
- 9H-Carbazole, 2-bromo-
- Carbazole, 2-bromo-
- 2-Bromo-9H-carbazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromocarbazole
CAS:Formula:C12H8BrNPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:246.11Ref: IN-DA00BXR2
1g20.00€5g26.00€10g28.00€1kgTo inquire25g52.00€5kgTo inquire100g120.00€500g561.00€250mg22.00€2-Bromo-9H-carbazole
CAS:2-Bromo-9H-carbazoleFormula:C12H8BrNPurity:≥95%Color and Shape: off-white to faint brown powderMolecular weight:246.10g/mol2-Bromocarbazole
CAS:2-Bromocarbazole is an organic compound that binds to the mineralocorticoid receptor. It has been shown to be a potent inhibitor of sodium transport in both anhydrous and hydrated conditions. 2-Bromocarbazole is also a cationic polymerization agent, which can be used in photophysical studies. This compound has been shown to have fluorescence properties, as well as receptor α binding capabilities. 2-Bromocarbazole was also able to inhibit the enzyme picolinic acid carboxylase, which catalyzes the conversion of picolinic acid into nicotinamide adenine dinucleotide phosphate (NADP) and CO2. The molecular docking analysis of 2-bromocarbazole with human recombinant MRAPα confirms this inhibition.
Formula:C12H8BrNPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:246.1 g/mol




