CymitQuimica logo

CAS 3653-39-2

:

Benzimine

Description:
Benzimine, with the CAS number 3653-39-2, is an organic compound characterized by the presence of an imine functional group (–C=N–) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. Benzimine is known for its aromatic properties, which contribute to its stability and reactivity. It can participate in various chemical reactions, including nucleophilic additions and condensation reactions, due to the electrophilic nature of the carbon atom in the imine group. Additionally, benzimine may exhibit biological activity, making it of interest in medicinal chemistry and research. Its solubility in organic solvents, such as ethanol and ether, allows for diverse applications in synthesis and as an intermediate in the production of other chemical compounds. Safety precautions should be observed when handling benzimine, as it may pose health risks if inhaled or ingested.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c15-13(12-8-4-3-5-9-12)14-10-6-1-2-7-11-14/h3-5,8-9H,1-2,6-7,10-11H2
InChI key:InChIKey=KZLCCMBSJDXNDG-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=CC=C1)N2CCCCCC2
Synonyms:
  • 1-Benzoylhexamethylenimine
  • (Hexahydro-1H-azepin-1-yl)phenylmethanone
  • Hexamethylenimine, 1-benzoyl-
  • 1H-Azepine, 1-benzoylhexahydro-
  • Methanone, (hexahydro-1H-azepin-1-yl)phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.