CymitQuimica logo

CAS 3653-53-0

:

N~4~-{7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl}-N~1~,N~1~-diethylpentane-1,4-diamine tris(phosphate)

Description:
The chemical substance known as N~4~-{7-chloro-2-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-4-yl}-N~1~,N~1~-diethylpentane-1,4-diamine tris(phosphate) is a complex organic compound characterized by its unique structural features. It contains a quinoline moiety, which is a bicyclic aromatic compound known for its biological activity, particularly in medicinal chemistry. The presence of chlorine substituents enhances its reactivity and potential pharmacological properties. The compound also features a diethylpentane-1,4-diamine backbone, contributing to its amine functionality, which can participate in various chemical interactions. The tris(phosphate) groups indicate that the compound has multiple phosphate functionalities, which may influence its solubility, stability, and interaction with biological systems. Overall, this substance is likely to exhibit significant biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its complex structure suggests potential applications in areas such as cancer treatment or as an antimicrobial agent, although specific biological effects would require further investigation.
Formula:C26H40Cl2N3O12P3
InChI:InChI=1/C26H31Cl2N3.3H3O4P/c1-4-31(5-2)16-8-9-19(3)29-26-18-22(14-12-20-10-6-7-11-24(20)28)30-25-17-21(27)13-15-23(25)26;3*1-5(2,3)4/h6-7,10-15,17-19H,4-5,8-9,16H2,1-3H3,(H,29,30);3*(H3,1,2,3,4)/b14-12+;;;
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.