![[(NE,Z)-N'-anilino-N-phenylimino-carbamimidoyl]sulfanylsilver](https://static.cymitquimica.com/cas-image/496450-ne-z-n-anilino-n-phenylimino-carbamimidoyl-sulfanylsilver.png)
CAS 36539-86-3: [(NE,Z)-N'-anilino-N-phenylimino-carbamimidoyl]sulfanylsilver
Description:The chemical substance known as "[(NE,Z)-N'-anilino-N-phenylimino-carbamimidoyl]sulfanylsilver," with the CAS number 36539-86-3, is a complex organosilver compound. It features a silver atom coordinated with a sulfanyl group and a carbamimidoyl moiety, which is further substituted with anilino and phenylimino groups. This compound is characterized by its unique structural arrangement, which includes both nitrogen and sulfur functionalities, contributing to its potential reactivity and applications in various fields, such as catalysis or materials science. The presence of the silver atom suggests potential antimicrobial properties, while the organic ligands may impart specific electronic and steric characteristics. The compound's stability, solubility, and reactivity can vary significantly depending on the surrounding environment, including factors like pH and temperature. As with many organometallic compounds, careful handling and consideration of safety protocols are essential due to the potential toxicity associated with silver and its compounds. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H11AgN4S
InChI:InChI=1/C13H12N4S.Ag/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12;/h1-10,14H,(H,16,18);/q;+1/p-1/b17-15+;/rC13H11AgN4S/c14-19-13(17-15-11-7-3-1-4-8-11)18-16-12-9-5-2-6-10-12/h1-10,15H/b17-13-,18-16+
- Synonyms:
- Silver(1+) (E)-N,2-diphenyldiazenecarbohydrazonothioate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Dithizone Silver Complex REF: 3B-D1679CAS: | >97.0%(T) | To inquire | Wed 02 Apr 25 |
 | DITHIZONE SILVER COMPLEX REF: IN-DA003PS9CAS: 36539-86-3 | 97% | To inquire | Wed 09 Apr 25 |
 | Dithizone Silver Complex REF: 3D-LBA53986CAS: 36539-86-3 | Min. 95% | - - - | Discontinued product |
Dithizone Silver Complex
Ref: 3B-D1679
| 1g | 111.00 € |
DITHIZONE SILVER COMPLEX
Ref: IN-DA003PS9
| 200mg | 62.00 € |
Dithizone Silver Complex
Ref: 3D-LBA53986
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
