CAS 365400-11-9
:Pyrasulfotole
Description:
Pyrasulfotole is a selective herbicide primarily used for the control of broadleaf weeds and certain grasses in various crops, particularly in cereal production. It belongs to the class of sulfonylurea herbicides and functions by inhibiting the enzyme 4-hydroxyphenylpyruvate dioxygenase (HPPD), which is crucial for the biosynthesis of carotenoids in plants. This inhibition leads to the disruption of photosynthesis and ultimately plant death. Pyrasulfotole is characterized by its systemic action, allowing it to be absorbed by plant roots and leaves, providing effective weed control. It is typically applied pre-emergence or post-emergence, depending on the target weeds and crop type. The substance is known for its low toxicity to mammals and birds, making it a relatively safe option for agricultural use when applied according to label instructions. However, as with all herbicides, it is essential to follow best management practices to minimize environmental impact and prevent the development of herbicide-resistant weed populations.
Formula:C14H13F3N2O4S
InChI:InChI=1S/C14H13F3N2O4S/c1-7-11(13(21)19(2)18-7)12(20)9-5-4-8(14(15,16)17)6-10(9)24(3,22)23/h4-6,21H,1-3H3
InChI key:InChIKey=DWSPRBSLSXQIEJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(S(C)(=O)=O)C=C(C(F)(F)F)C=C1)C2=C(O)N(C)N=C2C
Synonyms:- (5-Hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone
- 365400-11-9
- Methanone, (5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]-
- Pyrasulfotole
- T5Nnj A1 C1 Dvr Dxfff Bsw1& Eq
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pyrasulfotole
CAS:Controlled ProductApplications Pyrasulfotole (P847008) is a 4-hydroxyphenylppvate dioxygenase (HPPD) inhibitor herbicide, used in controlling post-emergence weeds in small grains cultures.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C14H13F3N2O4SColor and Shape:NeatMolecular weight:362.32Pyrasulfotole
CAS:Pyrasulfotole is a sulfonylurea herbicide that is used to control broadleaf weeds in crops such as wheat and corn. It acts by inhibiting the enzyme acetolactate synthase (ALS) in plants, which is necessary for the biosynthesis of the branched-chain amino acids valine, leucine, and isoleucine. Pyrasulfotole binds to ALS and prevents the formation of an enzyme-substrate complex. This results in a decrease in the levels of these essential amino acids, leading to chlorosis and death of the plant. Pyrasulfotole has been shown to be effective against weeds such as Triticum aestivum, but not against related species such as Triticum compactum.Formula:C14H13F3N2O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:362.33 g/mol


