CymitQuimica logo

CAS 365427-30-1

:

4-bromo-1-methyl-1H-indazole

Description:
4-Bromo-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 4-position and a methyl group at the 1-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit various chemical reactivities, including electrophilic substitution and nucleophilic attack, owing to the presence of the bromine atom, which can serve as a leaving group. Additionally, the methyl group can influence the compound's lipophilicity and solubility in organic solvents. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 4-bromo-1-methyl-1H-indazole is of interest in research for its structural features and potential applications in drug discovery.
Formula:C8H7BrN2
InChI:InChI=1/C8H7BrN2/c1-11-8-4-2-3-7(9)6(8)5-10-11/h2-5H,1H3
InChI key:AQUSISHVASVOBL-UHFFFAOYSA-N
SMILES:Cn1c2cccc(c2cn1)Br
Synonyms:
  • 1H-Indazole, 4-bromo-1-methyl-
  • 4-Bromo-1-mehtyl-1H-indazole
Found 4 products.