CAS 365526-34-7

methyl 4-chloro-3-iodobenzoate

Description:

Methyl 4-chloro-3-iodobenzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety with both chlorine and iodine substituents. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the chlorine and iodine atoms introduces significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 4-chloro-3-iodobenzoate is typically used in synthetic organic chemistry as an intermediate for the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Its molecular structure allows for diverse applications in research and industry, particularly in the development of compounds with specific biological activities. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound exemplifies the versatility of halogenated aromatic esters in chemical synthesis.

Formula: C₈H₆ClIO₂

InChI: InChI=1/C8H6ClIO2/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4H,1H3

SMILES: COC(=O)c1ccc(c(c1)I)Cl

Synonyms:

• Benzoic acid, 4-chloro-3-iodo-, methyl ester
• Methyl 4-chloro-3-iodobenzoate

Methyl 4-chloro-3-iodobenzoate

CAS: 365526-34-7

Formula: C₈H₆ClIO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 296.4895

Ref: IN-DA00C7GH

Methyl 4-chloro-3-iodobenzoate

CAS: 365526-34-7

Methyl 4-chloro-3-iodobenzoate

Purity: 98%

Color and Shape: Liquid

Molecular weight: 296.49g/mol

Ref: 54-OR55164

Methyl 3-Iodo-4-chlorobenzoate

CAS: 365526-34-7

Formula: C₈H₆ClIO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 296.49

Ref: 10-F038619

Methyl 4-chloro-3-iodobenzoate

CAS: 365526-34-7

Versatile small molecule scaffold

Formula: C₈H₆ClIO₂

Purity: Min. 95%

Molecular weight: 296.49 g/mol

Ref: 3D-QPA52634