CAS 36554-97-9: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-Triacontafluoro-8,10-heptadecanedione
Description:1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-Triacontafluoro-8,10-heptadecanedione, with CAS number 36554-97-9, is a highly fluorinated organic compound characterized by a long carbon chain and multiple fluorine substituents. This compound features a diketone functional group, which contributes to its reactivity and potential applications in various chemical processes. The presence of numerous fluorine atoms imparts unique properties, such as increased hydrophobicity and thermal stability, making it suitable for use in specialized coatings, surfactants, and other advanced materials. Its structure suggests that it may exhibit low volatility and high resistance to degradation, which are desirable traits in many industrial applications. Additionally, the fluorinated nature of the compound may influence its interactions with biological systems, necessitating careful consideration of its environmental impact and safety profile. Overall, this compound exemplifies the unique characteristics of fluorinated organic molecules, combining stability with potential utility in various fields.
Formula:C17H2F30O2
InChI:InChI=1S/C17H2F30O2/c18-4(19,6(22,23)8(26,27)10(30,31)12(34,35)14(38,39)16(42,43)44)2(48)1-3(49)5(20,21)7(24,25)9(28,29)11(32,33)13(36,37)15(40,41)17(45,46)47/h1H2
InChI key:InChIKey=ZXHJIRSEEIEAQG-UHFFFAOYSA-N
SMILES:O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-Triacontafluoro-8,10-heptadecanedione
- 8,10-Heptadecanedione, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-Triacontafluoro-
- 9,9-Dihydroperfluoro-8,10-heptadecanedione
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 9H,9H-PERFLUORO-8,10-HEPTADECANEDIONE REF: IN-DA003NL5CAS: 36554-97-9 | 98% | 89.00 € | Fri 02 May 25 |
![]() | 9H,9H-Triacontafluoro-8,10-heptadecanedione REF: 3D-FT60548CAS: 36554-97-9 | Min. 95% | - - - | Discontinued product |

9H,9H-PERFLUORO-8,10-HEPTADECANEDIONE
- Inorganic Compounds
- Diketone Ligands
- Carbonyls
- Fluorinated Compounds
- See more categories
- Ketones
Ref: IN-DA003NL5
10mg | 89.00 € |

9H,9H-Triacontafluoro-8,10-heptadecanedione
Ref: 3D-FT60548
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |