CymitQuimica logo

CAS 365542-46-7

:

Quinoline, 4-[2-[4-[2-methoxy-5-[2-(4-quinolinyl)ethyl]phenoxy]phenyl]ethyl]-

Description:
Quinoline, 4-[2-[4-[2-methoxy-5-[2-(4-quinolinyl)ethyl]phenoxy]phenyl]ethyl]- is a complex organic compound characterized by its quinoline and phenyl moieties. It features a quinoline ring, which is a bicyclic structure known for its aromatic properties and is often associated with biological activity. The presence of methoxy and ethyl groups enhances its solubility and may influence its interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to its multiple aromatic rings, which can facilitate membrane permeability. Additionally, the presence of various functional groups suggests potential for diverse chemical reactivity, making it of interest in medicinal chemistry and drug development. Its specific applications may include roles as a pharmaceutical agent or as a probe in biochemical research, although detailed studies would be necessary to elucidate its biological activity and therapeutic potential. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C35H30N2O2
InChI:InChI=1S/C35H30N2O2/c1-38-34-19-14-26(11-16-28-21-23-37-33-9-5-3-7-31(28)33)24-35(34)39-29-17-12-25(13-18-29)10-15-27-20-22-36-32-8-4-2-6-30(27)32/h2-9,12-14,17-24H,10-11,15-16H2,1H3
InChI key:InChIKey=ZEVFJEMWWOAJOC-UHFFFAOYSA-N
SMILES:C(CC1=CC(OC2=CC=C(CCC=3C4=C(N=CC3)C=CC=C4)C=C2)=C(OC)C=C1)C=5C6=C(N=CC5)C=CC=C6
Synonyms:
  • Quinoline, 4-[2-[4-[2-methoxy-5-[2-(4-quinolinyl)ethyl]phenoxy]phenyl]ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.