CAS 365543-24-4

Ethyl 2-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxybenzoate

Description:

Ethyl 2-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxybenzoate, identified by its CAS number 365543-24-4, is an organic compound characterized by its complex structure, which includes an ethyl ester functional group, a vinyl group, and multiple hydroxyl groups. This compound features a benzoate moiety, which contributes to its aromatic properties, and the presence of hydroxyl groups enhances its potential for hydrogen bonding, influencing its solubility and reactivity. The compound is likely to exhibit antioxidant properties due to the presence of the dihydroxyphenyl group, which can scavenge free radicals. Its structural features suggest potential applications in pharmaceuticals or as a biochemical probe, particularly in studies related to phenolic compounds and their derivatives. The compound's stability, reactivity, and interaction with biological systems would be of interest in various fields, including medicinal chemistry and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₇H₁₆O₅

InChI: InChI=1S/C17H16O5/c1-2-22-17(21)16-12(4-3-5-14(16)19)8-6-11-7-9-13(18)15(20)10-11/h3-10,18-20H,2H2,1H3/b8-6+

InChI key: InChIKey=WVNVHOPWQXYSDT-SOFGYWHQSA-N

SMILES: C(=C/C1=CC(O)=C(O)C=C1)\C2=C(C(OCC)=O)C(O)=CC=C2

Synonyms:

• Benzoic acid, 2-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxy-, ethyl ester
• Ethyl 2-[(1E)-2-(3,4-dihydroxyphenyl)ethenyl]-6-hydroxybenzoate