CAS 36556-51-1: 2,3-Dichloro-1-fluoro-4-nitrobenzene

Description:2,3-Dichloro-1-fluoro-4-nitrobenzene is an aromatic compound characterized by the presence of multiple halogen and nitro functional groups. It features a benzene ring substituted with two chlorine atoms at the 2 and 3 positions, a fluorine atom at the 1 position, and a nitro group at the 4 position. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemicals. Its molecular structure contributes to its reactivity, making it useful in electrophilic substitution reactions. The presence of electronegative substituents like chlorine and fluorine can influence the compound's physical properties, such as solubility and boiling point, as well as its chemical behavior. Additionally, 2,3-Dichloro-1-fluoro-4-nitrobenzene may exhibit toxicity and environmental persistence, necessitating careful handling and disposal in accordance with safety regulations.

Formula:C₆H₂Cl₂FNO₂

InChI:InChI=1S/C6H2Cl2FNO2/c7-5-3(9)1-2-4(6(5)8)10(11)12/h1-2H

InChI key:InChIKey=QWQJCMSWGFVURH-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=C(F)C(Cl)=C1Cl

Synonyms:
2,3-Dichloro-4-Fluoronitrobenzene
Benzene, 2,3-Dichloro-1-Fluoro-4-Nitro-
2,3-Dichloro-1-fluoro-4-nitrobenzene
1,2-Dichloro-3-fluoro-6-nitrobenzene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,3-Dichloro-4-fluoronitrobenzene REF: IN-DA00C768CAS: 36556-51-1	98%	25.00 €~239.00 €	Tue 06 May 25
2,3-Dichloro-4-fluoronitrobenzene REF: 54-PC3682CAS: 36556-51-1	97%	32.00 €~326.00 €	Mon 05 May 25
2,3-Dichloro-4-fluoronitrobenzene REF: 10-F210720CAS: 36556-51-1	95.0%	To inquire	Wed 14 May 25
2,3-dichloro-1-fluoro-4-nitrobenzene REF: 3D-FD105449CAS: 36556-51-1	Min. 95%	- - -	Discontinued product