
CAS 36556-56-6
:6-Chloro-2,4-difluoroaniline
Description:
6-Chloro-2,4-difluoroaniline is an organic compound characterized by the presence of an aniline structure substituted with chlorine and fluorine atoms. Specifically, it features a chlorine atom at the 6-position and two fluorine atoms at the 2 and 4 positions of the benzene ring. This compound is typically a solid at room temperature and is known for its potential applications in the synthesis of pharmaceuticals and agrochemicals. Its molecular formula is C6H4ClF2N, indicating the presence of carbon, hydrogen, chlorine, fluorine, and nitrogen. The presence of electronegative halogen atoms can influence its reactivity and solubility, making it a subject of interest in various chemical reactions. Additionally, 6-Chloro-2,4-difluoroaniline may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and substituents. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.
Formula:C6H4ClF2N
InChI:InChI=1/C6H4ClF2N/c7-6-4(9)1-3(8)2-5(6)10/h1-2H,10H2
SMILES:c1c(cc(c(c1F)Cl)N)F
Synonyms:- 2-Chloro-4,6-Difluoroaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4,6-difluoroaniline
CAS:Formula:C6H4ClF2NPurity:96%Color and Shape:SolidMolecular weight:163.55252-Chloro-4,6-difluoroaniline
CAS:Formula:C6H4ClF2NPurity:>98.0%(GC)(T)Color and Shape:White to Brown to Dark purple powder to crystalMolecular weight:163.552-Chloro-4,6-difluoroaniline
CAS:2-Chloro-4,6-difluoroanilineFormula:C6H4ClF2NPurity:98%Color and Shape: yellow solidMolecular weight:163.55g/mol2-Chloro-4,6-difluoroaniline
CAS:2-Chloro-4,6-difluoroaniline is a versatile chemical building block that can be used in the synthesis of complex compounds. It is a reactive intermediate compound and can be used to synthesize speciality chemicals for research purposes. 2-Chloro-4,6-difluoroaniline has been shown to have high quality and is useful as a reagent or reaction component. This product is also functional as an intermediate for the synthesis of other compounds.Formula:C6H4ClF2NPurity:Min. 95%Color and Shape:PowderMolecular weight:163.55 g/mol2-Chloro-4,6-difluoroaniline
CAS:Formula:C6H4ClF2NPurity:96%Color and Shape:SolidMolecular weight:163.55




