CAS 36556-77-1
:2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide
Description:
2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide, with the CAS number 36556-77-1, is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic structure containing three nitrogen atoms. This compound features an amino group and a chloro substituent, contributing to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. The presence of the methylpropanamide moiety suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological systems. The chloro group may also impart specific chemical reactivity, making it useful in synthetic pathways. Overall, this compound's unique structure allows for diverse applications, particularly in the development of herbicides or other agrochemicals, due to its ability to interact with biological targets. Its stability and reactivity are influenced by the triazine ring and the functional groups attached to it, making it a subject of interest in chemical research.
Formula:C7H11ClN6O
InChI:InChI=1S/C7H11ClN6O/c1-7(2,3(9)15)14-6-12-4(8)11-5(10)13-6/h1-2H3,(H2,9,15)(H3,10,11,12,13,14)
InChI key:InChIKey=NDKHTXLRCBVLMO-UHFFFAOYSA-N
SMILES:N(C(C(N)=O)(C)C)C=1N=C(Cl)N=C(N)N1
Synonyms:- 2-Chloro-4-(1-carbamoyl-1-methylethylamino)-6-amino-1,3,5-triazine
- 2-Chloro-4-(1-carbamoyl-1-methylethylamino)-6-aminotriazine
- 2-[(4-Amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide
- N-Deethylcyanazine amide
- N~2~-(4-Amino-6-chlor-1,3,5-triazin-2-yl)-2-methylalaninamid
- Propanamide, 2-[(4-Amino-6-Chloro-1,3,5-Triazin-2-Yl)Amino]-2-Methyl-
- N~2~-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-méthylalaninamide
- N~2~-(4-Amino-6-chloro-1,3,5-triazin-2-yl)-2-methylalaninamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Deethylcyanazine amide
CAS:Controlled ProductFormula:C7H11ClN6OColor and Shape:NeatMolecular weight:230.65
