CAS 36557-18-3

Butanoic acid, (1,2-diethyl-1,2-ethanediyl)di-4,1-phenylene ester

Description:

Butanoic acid, (1,2-diethyl-1,2-ethanediyl)di-4,1-phenylene ester, identified by CAS number 36557-18-3, is an organic compound characterized by its ester functional group derived from butanoic acid and a di-phenylene structure. This compound typically exhibits a moderate molecular weight and is likely to be a viscous liquid or solid at room temperature, depending on its specific structural arrangement. The presence of the diethyl and phenylene groups suggests that it may have hydrophobic characteristics, influencing its solubility in organic solvents rather than water. Additionally, the compound may display interesting thermal and chemical stability due to the aromatic rings, which can provide rigidity and resistance to degradation. Its potential applications could range from use in plastics and polymers to specialty chemicals, depending on its reactivity and compatibility with other materials. As with many esters, it may also have a characteristic odor. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₂₆H₃₄O₄

InChI: InChI=1S/C26H34O4/c1-5-9-25(27)29-21-15-11-19(12-16-21)23(7-3)24(8-4)20-13-17-22(18-14-20)30-26(28)10-6-2/h11-18,23-24H,5-10H2,1-4H3

InChI key: InChIKey=JTBPVVVYALFNNO-UHFFFAOYSA-N

SMILES: C(C(CC)C1=CC=C(OC(CCC)=O)C=C1)(CC)C2=CC=C(OC(CCC)=O)C=C2

Synonyms:

• Butanoic acid, (1,2-diethyl-1,2-ethanediyl)di-4,1-phenylene ester
• Hexestrol dibutyrate

Hexestrol dibutyrate

CAS: 36557-18-3

Hexestrol dibutyrate: Synthetic ER activator, microtubule blocker, possible carcinogen, causes mitotic arrest, aneuploidy, and DNA adducts.

Formula: C₂₆H₃₄O₄

Color and Shape: Solid

Molecular weight: 410.55

Ref: TM-T69352