CAS 36558-41-5
:Thiodiphosphoric acid ([(HO)2P(S)]2O)
Description:
Thiodiphosphoric acid, with the chemical formula [(HO)2P(S)]2O and CAS number 36558-41-5, is an organophosphorus compound characterized by the presence of two phosphoric acid groups linked by a sulfur atom. This compound typically appears as a colorless to pale yellow liquid and is soluble in water, reflecting its polar nature due to the hydroxyl groups. Thiodiphosphoric acid exhibits properties typical of phosphoric acids, including the ability to act as a weak acid, donating protons in solution. Its structure allows for potential applications in various fields, including agriculture as a pesticide or herbicide, and in the synthesis of other organophosphorus compounds. Additionally, it may serve as a flame retardant or plasticizer in polymer chemistry. The presence of sulfur in its structure can impart unique reactivity and stability characteristics compared to other phosphoric acids. Safety considerations are important, as organophosphorus compounds can exhibit toxicity, necessitating careful handling and usage in industrial and laboratory settings.
Formula:H4O5P2S2
InChI:InChI=1S/H4O5P2S2/c1-6(2,8)5-7(3,4)9/h(H2,1,2,8)(H2,3,4,9)
InChI key:InChIKey=CIFZCCWGXMYJEU-UHFFFAOYSA-N
SMILES:O(P(=O)(O)S)P(=O)(O)S
Synonyms:- Dithiopyrophosphoric acid
- Thiodiphosphoric acid ([(HO)<sub>2</sub>P(S)]<sub>2</sub>O)
- Thiopyrophosphoric acids, (HO)<sub>2</sub>SPOPS(OH)<sub>2</sub>
- Thiopyrophosphoricacids, (HO)2SPOPS(OH)2 (5CI)
- Thiopyrophosphoric acids, (HO)2SPOPS(OH)2
- Thiodiphosphoric acid ([(HO)2P(S)]2O)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dithiopyrophosphoric Acid
CAS:Controlled ProductFormula:H4O5P2S2Color and Shape:NeatMolecular weight:210.106
