CAS 36561-33-8
:Ethoxyethyl methacrylate polymer
Description:
Ethoxyethyl methacrylate polymer, identified by its CAS number 36561-33-8, is a synthetic polymer derived from the polymerization of ethoxyethyl methacrylate monomers. This polymer exhibits several notable characteristics, including good adhesion properties, flexibility, and resistance to water and various chemicals, making it suitable for applications in coatings, adhesives, and sealants. Ethoxyethyl methacrylate contributes to the polymer's ability to form films that are both durable and transparent. Additionally, the presence of ethoxy groups enhances the polymer's compatibility with other materials and improves its processing characteristics. The polymer typically demonstrates thermal stability and can be processed through various methods, including extrusion and molding. Its versatility allows it to be utilized in diverse industries, including automotive, construction, and consumer goods. Overall, Ethoxyethyl methacrylate polymer is valued for its balance of mechanical strength and chemical resistance, making it a useful material in many commercial applications.
Formula:(C8H14O3)x
InChI:InChI=1S/C8H14O3/c1-4-10-5-6-11-8(9)7(2)3/h2,4-6H2,1,3H3
InChI key:InChIKey=SFPNZPQIIAJXGL-UHFFFAOYSA-N
SMILES:C(OCCOCC)(C(C)=C)=O
Synonyms:- Ethoxyethyl methacrylate polymer
- 2-Ethoxyethyl methacrylate polymer
- Methacrylic acid, 2-ethoxyethyl ester, polymers
- 2-Propenoic acid, 2-methyl-, 2-ethoxyethyl ester, homopolymer
- Poly(ethoxyethyl methacrylate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
