CAS 36562-70-6

Polyguluronic acid

Description:

Polyguluronic acid is a polysaccharide composed primarily of repeating units of guluronic acid, a uronic acid derived from the oxidation of glucose. It is a key component of alginates, which are naturally occurring polysaccharides found in brown seaweeds. Characteristically, polyguluronic acid exhibits gel-forming properties, making it useful in various applications, including food, pharmaceuticals, and biotechnology. Its structure allows for the formation of stable gels in the presence of divalent cations, such as calcium ions, which can cross-link the polymer chains. This property is exploited in drug delivery systems and tissue engineering. Additionally, polyguluronic acid is known for its biocompatibility and biodegradability, making it an attractive material for environmentally friendly applications. The substance is typically soluble in water, and its viscosity can vary depending on concentration and the presence of other ions or molecules. Overall, polyguluronic acid's unique chemical properties and versatility make it a valuable compound in both industrial and research settings.

Formula: (C₆H₁₀O₇)x

InChI: InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3-,4+,5-/s2

InChI key: InChIKey=IAJILQKETJEXLJ-LPBVRZIONA-N

SMILES: [C@@H]([C@H]([C@H](C=O)O)O)([C@@H](C(O)=O)O)O

Synonyms:

• Polyguluronic acid
• Guluronic acid, homopolymer
• Polyguluronate

Polyguluronic acid

CAS: 36562-70-6

Polyguluronic acid is produced from alginates by partial hydrolysis and chromatography of brown algae such as Laminaria digitata, Ascophyllum nodosum and Fucus spp.
The image was kindly provided by Prof Mike Guiry from Cork who runs ‘The Seaweed Site’.MW is ca 6000 - 8000Da.poly-M levels are ca 3%

Purity: (%) Min. 80%

Color and Shape: Off-White Powder

Molecular weight: 194.14

Ref: 3D-YP03135

Polyguluronic Acid extrapure, 80%

CAS: 36562-70-6

Formula: C₆H₁₀O₇

Purity: min. 80.0%

Color and Shape: White to Yellow to Light brown, Powder

Molecular weight: 194.14

Ref: SR-67258