CAS 36574-83-1
:(2E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one
Description:
The chemical substance known as (2E)-1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one, with the CAS number 36574-83-1, is a type of chalcone, which is characterized by its structure featuring a central α,β-unsaturated carbonyl system flanked by two aromatic rings. This compound exhibits notable properties such as antioxidant, anti-inflammatory, and potential anticancer activities, making it of interest in medicinal chemistry. The presence of hydroxyl groups on the phenyl rings enhances its reactivity and solubility in polar solvents, contributing to its biological activity. Additionally, the compound may exhibit UV-Vis absorbance due to its conjugated double bond system, which can be utilized in various applications, including dye synthesis and as a potential lead compound in drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a significant area of study in organic chemistry and pharmacology.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-12-5-3-4-11(10-12)8-9-15(18)13-6-1-2-7-14(13)17/h1-10,16-17H/b9-8+
Synonyms:- 2',3-Dihydroxychalcone
- 2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)-
- 2-propen-1-one, 1-(2-hydroxyphenyl)-3-(3-hydroxyphenyl)-, (2E)-
- Chalcone, 2',3-dihydroxy-
- (2E)-1-(2-Hydroxyphenyl)-3-(3-hydroxyphenyl)prop-2-en-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3,2'-Dihydroxychalcone
CAS:3,2'-Dihydroxychalcone is a naturally occurring flavonoid, which is derived from various plant sources, particularly in fruits and vegetables known for their rich polyphenolic content. As a member of the chalcone family, this compound exhibits a distinctive chemical structure characterized by two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. The presence of hydroxyl groups contributes to its potential antioxidant properties, allowing it to effectively scavenge free radicals and mitigate oxidative stress.Formula:C15H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:240.25 g/mol

