CAS 36577-48-7

Carbonic acid, zirconium(4+) salt

Description:

Carbonic acid, zirconium(4+) salt, also known as zirconium carbonate, is an inorganic compound characterized by its formation from zirconium ions and carbonate ions. It typically appears as a white or off-white solid and is known for its low solubility in water, which can vary depending on the specific form and conditions. This compound is often utilized in various applications, including ceramics, catalysts, and as a precursor in the synthesis of zirconium-based materials. Its chemical structure features zirconium in a +4 oxidation state, coordinated with carbonate groups, which contributes to its stability and reactivity. Carbonic acid, zirconium(4+) salt can also exhibit properties such as thermal stability and resistance to corrosion, making it valuable in industrial processes. Additionally, it may play a role in biomedical applications, particularly in drug delivery systems or as a contrast agent in imaging techniques. Safety considerations should be taken into account, as with many metal salts, including proper handling and disposal methods to mitigate any potential environmental impact.

Formula: CH₂O₃·xZr

InChI: InChI=1S/CH2O3.Zr/c2-1(3)4;/h(H2,2,3,4);

InChI key: InChIKey=IUFBBBDTDAHZOQ-UHFFFAOYSA-N

SMILES: C(=O)(O)O.[Zr]

Synonyms:

• Carbonic acid, zirconium(4+) salt
• Zirconium dicarbonate
• Zirconium(2+) Dicarbonate
• Zirconium(IV)carbonate
• Zirconium carbonate

Zirconiumdicarbonate

CAS: 36577-48-7

Zirconiumdicarbonate is a zirconium compound that is used as an oxidation catalyst for wastewater treatment. The chemical stability of zirconiumdicarbonate makes it a good choice for this application because it can withstand harsh conditions. Zirconiumdicarbonate is typically used in conjunction with potassium dichromate, which oxidizes organic compounds and converts them to carbon dioxide, water vapor, and hydrogen chloride. The reaction mechanism involves the dimethyl fumarate being reduced to formaldehyde and methanol. These substances react with the zirconium oxide to produce hydrogen gas and water vapor. Zirconiumdicarbonate is also used in the production of polyvinyl chloride (PVC) plastics. Zirconiumdicarbonate reacts with sodium carbonate or sodium hydroxide to produce sodium dichromate or sodium hydroxide respectively.

Formula: C₂O₆Zr

Color and Shape: Powder

Molecular weight: 211.24 g/mol

Ref: 3D-FZ150107