CAS 365996-63-0

1,1-Dimethylethyl 2-bromo-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate

Description:

1,1-Dimethylethyl 2-bromo-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate, with the CAS number 365996-63-0, is a chemical compound characterized by its complex structure, which includes a pyrrolo-thiazole core. This compound features a bromo substituent, which typically enhances its reactivity and can influence its biological activity. The presence of the dimethyl group contributes to steric hindrance, potentially affecting its interaction with biological targets. As an ester, it may exhibit properties typical of carboxylate derivatives, such as solubility in organic solvents and potential hydrolysis under certain conditions. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms and functional groups that can participate in various chemical reactions. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical data or literature references for precise characterization.

Formula: C₁₀H₁₃BrN₂O₂S

InChI: InChI=1S/C10H13BrN2O2S/c1-10(2,3)15-9(14)13-4-6-7(5-13)16-8(11)12-6/h4-5H2,1-3H3

InChI key: InChIKey=CDSSEIKIKLGYMP-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2=C(C1)SC(Br)=N2

Synonyms:

• 1,1-Dimethylethyl 2-bromo-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate
• 2-Bromo-4,6-dihydro-pyrrolo[3,4-d]thiazole-5-carboxylic acid tert-butyl ester
• tert-Butyl 2-bromo-4,6-dihydro-5H-pyrrolo[3,4-d]thiazole-5-carboxylate
• 5H-Pyrrolo[3,4-d]thiazole-5-carboxylic acid, 2-bromo-4,6-dihydro-, 1,1-dimethylethyl ester

Tert-Butyl 2-Bromo-4H-Pyrrolo[3,4-D]Thiazole-5(6H)-Carboxylate

CAS: 365996-63-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrN₂O₂S

Purity: Min. 95%

Molecular weight: 305.19 g/mol

Ref: 3D-QPA99663