CymitQuimica logo

CAS 365997-32-6

:

Ethyl (1S,3R,4R)-3-azido-4-hydroxycyclohexanecarboxylate

Description:
Ethyl (1S,3R,4R)-3-azido-4-hydroxycyclohexanecarboxylate is a chemical compound characterized by its azido and hydroxy functional groups, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the cyclohexane ring provides a stable framework, while the carboxylate ester group enhances its solubility in organic solvents. The specific stereochemistry indicated by the (1S,3R,4R) configuration suggests that the compound has distinct spatial arrangements, which can influence its biological activity and interactions with other molecules. The azido group is particularly noteworthy, as it can participate in various click chemistry reactions, making this compound valuable for bioconjugation and drug development. Additionally, the hydroxy group may impart hydrogen bonding capabilities, affecting the compound's physical properties and reactivity. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and applications.
Formula:C9H15N3O3
InChI:InChI=1S/C9H15N3O3/c1-2-15-9(14)6-3-4-8(13)7(5-6)11-12-10/h6-8,13H,2-5H2,1H3/t6-,7+,8+/m0/s1
InChI key:InChIKey=ZSEPOKOVRBPMOH-XLPZGREQSA-N
SMILES:C(OCC)(=O)[C@@H]1C[C@@H](N=[N+]=[N-])[C@H](O)CC1
Synonyms:
  • Cyclohexanecarboxylic acid, 3-azido-4-hydroxy-, ethyl ester, (1S,3R,4R)-
  • Ethyl (1S,3R,4R)-3-azido-4-hydroxycyclohexanecarboxylate
  • (1S,3R,4R)-(+)-3-Azido-4-hydroxycyclohexanecarboxylic acid ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.