CAS 366012-74-0
:4-(6-methoxy-1H-benzimidazol-2-yl)aniline
Description:
4-(6-Methoxy-1H-benzimidazol-2-yl)aniline is an organic compound characterized by its unique structure, which includes a benzimidazole moiety and an aniline group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the methoxy group enhances its lipophilicity, which can influence its interaction with biological targets. The compound may also exhibit various functional properties, including potential antioxidant or antimicrobial activities, depending on its specific interactions within biological systems. Its molecular structure allows for various chemical modifications, which can be explored for developing derivatives with enhanced efficacy or selectivity in therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles can vary. Overall, 4-(6-methoxy-1H-benzimidazol-2-yl)aniline represents a class of compounds that are valuable in medicinal chemistry and drug development.
Formula:C14H13N3O
InChI:InChI=1/C14H13N3O/c1-18-11-6-7-12-13(8-11)17-14(16-12)9-2-4-10(15)5-3-9/h2-8H,15H2,1H3,(H,16,17)
SMILES:COc1ccc2c(c1)nc(c1ccc(cc1)N)[nH]2
Synonyms:- 4-(5-Methoxy-1H-benzimidazol-2-yl)aniline
- Benzenamine, 4-(5-methoxy-1H-benzimidazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
