CymitQuimica logo

CAS 36603-80-2

:

Methanetricarbonitrile, ion(1-), sodium

Description:
Methanetricarbonitrile, ion(1-), sodium, also known as sodium methanetricarbonitrile, is an inorganic compound characterized by its anionic form derived from methanetricarbonitrile. This compound features a central carbon atom bonded to three cyano (–C≡N) groups, resulting in a highly polar and reactive structure. The presence of the sodium ion (Na+) balances the negative charge of the methanetricarbonitrile anion, making it a stable salt. This compound is typically used in various chemical syntheses and applications, particularly in organic chemistry and materials science. Its properties include high solubility in polar solvents, which facilitates its use in reactions requiring ionic species. Additionally, the cyano groups contribute to its reactivity, allowing it to participate in nucleophilic addition and other chemical transformations. Safety considerations should be taken into account due to the toxicity associated with cyanide derivatives. Overall, sodium methanetricarbonitrile is a versatile compound with significant utility in chemical research and industrial applications.
Formula:C4N3Na
InChI:InChI=1S/C4N3.Na/c5-1-4(2-6)3-7;/q-1;+1
InChI key:LOYHZHALCDOXIK-UHFFFAOYSA-N
SMILES:C(#N)[C-](C#N)C#N.[Na+]
Found 6 products.