CAS 36614-32-1
:PGB3
Description:
PGB3, or 1,2-Propanediol, 3-(2-hydroxy-3-(2-methoxy-2-oxoethyl)-2-methyl-1-oxopropyl)-, is a chemical compound with the CAS number 36614-32-1. It is characterized as a viscous, colorless liquid that is soluble in water and organic solvents. PGB3 is primarily used as a solvent and a chemical intermediate in various industrial applications, including the production of pharmaceuticals and personal care products. Its structure features multiple functional groups, including hydroxyl and carbonyl groups, which contribute to its reactivity and ability to form hydrogen bonds. This compound is known for its low toxicity and is often considered a safer alternative to more hazardous solvents. Additionally, PGB3 exhibits good thermal stability and can be utilized in formulations requiring a stable and effective solvent system. As with any chemical, proper handling and safety precautions should be observed to minimize exposure and ensure safe usage in industrial and laboratory settings.
Formula:C20H28O4
InChI:InChI=1S/C20H28O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h3-4,6-7,12,14,17,21H,2,5,8-11,13,15H2,1H3,(H,23,24)/b6-3-,7-4-,14-12+/t17-/m0/s1
InChI key:InChIKey=DQRGQQAJYRBDRP-UNBCGXALSA-N
SMILES:C(/C=C\CCCC(O)=O)C1=C(/C=C/[C@H](C/C=C\CC)O)CCC1=O
Synonyms:- PGB3
- (5Z,13E,15S,17Z)-15-Hydroxy-9-oxoprosta-5,8(12),13,17-tetraen-1-oic acid
- Prosta-5,8(12),13,17-tetraen-1-oic acid, 15-hydroxy-9-oxo-, (5Z,13E,15S,17Z)-
- Prostaglandin B3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Prostaglandin B3
CAS:Prostaglandin B3 (PGB3) is a secondary alcohol belonging to the prostaglandin B class, characterized by its relatively low affinity for human PPARγ, exhibiting a K_i value greater than 1 mM, in contrast to PGB1 and PGB2, which have K_i values of 26.28 ± 8.7 μM and 77 ± 37.7 μM, respectively [1].Formula:C20H28O4Color and Shape:SolidMolecular weight:332.43
