
CAS 36614-38-7
:Isothioate
Description:
Isothioate refers to a class of chemical compounds characterized by the presence of the isothiocyanate functional group, which features a sulfur atom double-bonded to a carbon atom that is also bonded to a nitrogen atom. The specific compound with CAS number 36614-38-7 is known as 2-Isothiocyanato-1-methylpyridinium. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. Isothioates are often recognized for their biological activity, including potential applications in agriculture as pesticides or herbicides due to their ability to disrupt pest metabolism. Additionally, they may possess antimicrobial properties, making them of interest in various fields, including pharmaceuticals and food preservation. The stability of isothioates can vary based on environmental conditions, and they may undergo hydrolysis or other reactions in the presence of moisture or nucleophiles. Overall, isothioates are versatile compounds with significant implications in both industrial and research contexts.
Formula:C7H17O2PS3
InChI:InChI=1S/C7H17O2PS3/c1-7(2)12-5-6-13-10(11,8-3)9-4/h7H,5-6H2,1-4H3
InChI key:InChIKey=SPCNPOWOBZQWJK-UHFFFAOYSA-N
SMILES:P(SCCSC(C)C)(OC)(OC)=S
Synonyms:- Isothioate
- Phosphorodithioic acid, O,O-dimethyl S-[2-[(1-methylethyl)thio]ethyl] ester
- O,O-Dimethyl S-[2-(isopropylthio)ethyl] phosphorodithioate
- Hosalon
- S-(2-Isopropylthioethyl) O,O-dimethyl phosphorodithioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isothioate
CAS:Isothioate is a systemic insecticide with a fumigant effect that is effective against aphids.Formula:C7H17O2PS3Color and Shape:SolidMolecular weight:260.38
