CAS 36617-02-4
:(2-bromocyclopropyl)benzene
Description:
(2-Bromocyclopropyl)benzene is an organic compound characterized by the presence of a bromine atom attached to a cyclopropyl group, which is further connected to a benzene ring. This compound features a cyclopropane structure, known for its three-membered ring, which imparts unique strain and reactivity properties. The bromine substituent enhances the electrophilic character of the cyclopropyl group, making it a useful intermediate in various organic synthesis reactions. The presence of the benzene ring contributes to the compound's stability and aromatic characteristics, influencing its physical properties such as boiling and melting points. Typically, (2-bromocyclopropyl)benzene is a colorless to pale yellow liquid, and its reactivity can be attributed to the bromine atom, which can participate in nucleophilic substitution reactions. This compound is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential to undergo further transformations. Safety precautions should be observed when handling this compound, as it may pose health risks associated with brominated organic compounds.
Formula:C9H9Br
InChI:InChI=1/C9H9Br/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2
SMILES:c1ccc(cc1)C1CC1Br
Synonyms:- 1-Bromo-2-phenylcyclopropane
- Benzene, (2-bromocyclopropyl)-
- (2-BROMOCYCLOPROPYL)BENZENE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2-Bromocyclopropyl)benzene
CAS:2-Bromocyclopropyl)benzene is a nucleophilic compound that is activated by magnesium, yielding an organic halide. It has two structural isomers, one of which is the amide and the other the chloride. The reaction system for this compound is cyclopropylidene. 2-Bromocyclopropyl)benzene has been shown to be highly stereoselective and allylation reactions with it have been shown to be stereospecific.
Formula:C9H9BrPurity:Min. 95%Molecular weight:197.07 g/molRef: 3D-LBA61702
Discontinued product
