CAS 36617-18-2: lauric acid arachidyl ester
Description:Lauric acid arachidyl ester, identified by the CAS number 36617-18-2, is an ester formed from lauric acid and arachidyl alcohol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and specific formulation. It is characterized by its fatty acid structure, which contributes to its properties as a surfactant and emulsifier in various applications, particularly in cosmetics and personal care products. Lauric acid, a medium-chain fatty acid, imparts antimicrobial properties, while arachidyl alcohol, a long-chain fatty alcohol, enhances the texture and stability of formulations. The compound is generally soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Its melting and boiling points can vary based on the specific formulation and purity. Overall, lauric acid arachidyl ester is valued for its emollient properties, making it suitable for skin and hair care formulations, where it helps to improve moisture retention and enhance product spreadability.
Formula:C32H64O2
InChI:InChI=1/C32H64O2/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-29-31-34-32(33)30-28-26-24-22-12-10-8-6-4-2/h3-31H2,1-2H3
- Synonyms:
- Icosyl Dodecanoate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Arachidyl dodecanoate REF: 7W-GL3193CAS: 36617-18-2 | - - - | To inquire | Mon 28 Apr 25 |
![]() | Arachidyl Laurate REF: 48-45-1220CAS: 36617-18-2 | >99% | 67.00 €~201.00 € | Tue 29 Apr 25 |

Arachidyl Laurate
Ref: 48-45-1220
1g | 201.00 € | ||
100mg | 67.00 € |