CAS 36625-57-7

(5-nitropyridin-2-yl)methanol

Description:

(5-Nitropyridin-2-yl)methanol is an organic compound characterized by its pyridine ring structure, which is substituted with a nitro group at the 5-position and a hydroxymethyl group at the 2-position. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and methods of synthesis. Safety precautions should be taken when handling this compound, as nitro-substituted compounds can be hazardous. Overall, (5-nitropyridin-2-yl)methanol serves as a valuable intermediate in organic synthesis and research applications.

Formula: C₆H₆N₂O₃

InChI: InChI=1/C6H6N2O3/c9-4-5-1-2-6(3-7-5)8(10)11/h1-3,9H,4H2

SMILES: c1cc(cnc1CO)N(=O)=O

Synonyms:

• 2-Pyridinemethanol, 5-Nitro-
• 3-Nitro-6-pyridinemethanol
• (5-Nitropyridin-2-yl)methanol

3-NITRO-6-PYRIDINEMETHANOL

CAS: 36625-57-7

Formula: C₆H₆N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.1234

Ref: IN-DA00CA9W

(5-Nitropyridin-2-yl)methanol

CAS: 36625-57-7

(5-Nitropyridin-2-yl)methanol

Purity: 98%

Molecular weight: 154.12g/mol

Ref: 54-OR94606

(5-Nitropyridin-2-yl)methanol

CAS: 36625-57-7

Formula: C₆H₆N₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 154.125

Ref: 10-F234027