CAS 36626-29-6
:Phosphonium, (2-carboxyethyl)triphenyl-, chloride (1:1)
Description:
Phosphonium, (2-carboxyethyl)triphenyl-, chloride (1:1) is a quaternary ammonium compound characterized by a positively charged phosphonium ion and a chloride counterion. This compound features a triphenylphosphonium moiety, which is known for its lipophilicity and ability to penetrate biological membranes, making it of interest in various biochemical applications. The presence of a 2-carboxyethyl group introduces a polar functional group, enhancing its solubility in polar solvents and potentially influencing its reactivity and interactions in biological systems. The chloride ion serves as a counterion, balancing the positive charge of the phosphonium center. This compound may exhibit properties such as being a good ligand in coordination chemistry and having potential applications in drug delivery systems or as a reagent in organic synthesis. Its stability, solubility, and reactivity can be influenced by the surrounding environment, including pH and the presence of other ions or molecules. Overall, phosphonium compounds are valuable in both synthetic and medicinal chemistry due to their unique properties.
Formula:C21H20O2P·Cl
InChI:InChI=1S/C21H19O2P.ClH/c22-21(23)16-17-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15H,16-17H2;1H
InChI key:InChIKey=GALLWJZTZYJVSL-UHFFFAOYSA-N
SMILES:[P+](CCC(O)=O)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
Synonyms:- (2-Carboxyethyl)(triphenyl)phosphonium
- (β-Carboxyethyl)triphenylphosphonium chloride
- 3-(Triphenylphosphonium)propionic acid chloride
- NSC 165227
- Phosphonium, (2-carboxyethyl)triphenyl-
- Phosphonium, (2-carboxyethyl)triphenyl-, chloride
- Phosphonium, (2-carboxyethyl)triphenyl-, chloride (1:1)
- Triphenyl(2-carboxyethyl)phosphonium chloride
- (2-Carboxyethyl)triphenylphosphonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(2-Carboxyethyl)triphenylphosphonium chloride, 98%
CAS:2-Carboxyethyl)-triphenylphosphonium chloride is a phosphonium ylide reagent for Wittig olefinations with introduction of a carboxylic acid. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to tFormula:C21H20ClO2PPurity:98%Color and Shape:Crystals or powder or crystalline powder, White to pale creamMolecular weight:370.81(2-Carboxyethyl)triphenylphosphonium chloride
CAS:Formula:C21H20ClO2PPurity:98%Color and Shape:SolidMolecular weight:370.8091(2-Carboxyethyl)(triphenyl)phosphonium chloride
CAS:(2-Carboxyethyl)(triphenyl)phosphonium chlorideFormula:C21H20O2P·ClPurity:99%Color and Shape: white powderMolecular weight:370.80906g/mol(2-carboxyethyl)(triphenyl)phosphonium chloride
CAS:Formula:C21H20ClO2PPurity:98%Color and Shape:SolidMolecular weight:370.81(2-Carboxyethyl)-triphenylphosphonium Chloride
CAS:Controlled ProductApplications (2-Carboxyethyl)-triphenylphosphonium Chloride (cas# 36626-29-6) is a compound useful in organic synthesis.
Formula:C21H20O2P·ClColor and Shape:NeatMolecular weight:370.81





