CAS 3663-38-5

3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine

Description:

3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine, with the CAS number 3663-38-5, is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a 4-methylphenyl group, which contributes to its aromatic properties and may influence its reactivity and solubility. The presence of an amino group (-NH2) at the 5-position of the oxadiazole ring enhances its potential for hydrogen bonding and reactivity in various chemical reactions. Typically, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Additionally, the compound may be used in various applications, including as a building block in organic synthesis or as a potential pharmaceutical agent, depending on its biological activity and functional properties.

Formula: C₉H₉N₃O

InChI: InChI=1S/C9H9N3O/c1-6-2-4-7(5-3-6)8-11-9(10)13-12-8/h2-5H,1H3,(H2,10,11,12)

InChI key: InChIKey=KDFPLANNPDPZTN-UHFFFAOYSA-N

SMILES: NC1=NC(C2=CC=C(C)C=C2)=NO1

Synonyms:

• 1,2,4-Oxadiazol-5-amine, 3-(4-methylphenyl)-
• 1,2,4-Oxadiazole, 5-amino-3-p-tolyl-
• 3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine

3-(4-Methylphenyl)-1,2,4-oxadiazol-5-amine

CAS: 3663-38-5

Versatile small molecule scaffold

Formula: C₉H₉N₃O

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-DAA66338