CAS 3663-46-5
:(2,2,5-trimethyl-1,3-dioxan-5-yl)methanol
Description:
(2,2,5-trimethyl-1,3-dioxan-5-yl)methanol, with the CAS number 3663-46-5, is an organic compound characterized by its dioxane structure, which includes a five-membered ring containing two oxygen atoms. This compound features multiple methyl groups, contributing to its branched structure and influencing its physical properties. Typically, such compounds exhibit moderate polarity due to the presence of hydroxyl (-OH) groups, which can engage in hydrogen bonding, enhancing their solubility in polar solvents like water. The presence of the dioxane ring may also impart stability and influence reactivity, making it useful in various chemical applications, including as a solvent or intermediate in organic synthesis. Additionally, the branched nature of the molecule can affect its boiling point and melting point, generally leading to lower volatility compared to linear counterparts. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H16O3
InChI:InChI=1/C8H16O3/c1-7(2)10-5-8(3,4-9)6-11-7/h9H,4-6H2,1-3H3
SMILES:CC1(C)OCC(C)(CO)CO1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-HydroxyMethyl-2,2,5-triMethyl-1,3-dioxane
CAS:Formula:C8H16O3Purity:98%Color and Shape:SolidMolecular weight:160.21082,2-Dimethyl-1,3-dioxane-5-methyl-5-methanol
CAS:<p>2,2-Dimethyl-1,3-dioxane-5-methyl-5-methanol is a metallacycle that is synthesized by hydrolysis of 2,2-dimethyl-1,3-dioxane. Hydrolysis of the methyl ether leads to formation of the methoxy group at the 2 position. The dioxane ring is opened by reaction with zinc and hydrochloric acid to form the methylene bridge between the two carbon atoms. This compound can be used in elemental analysis and as an intermediate in high yield synthesis of dinuclear complexes. Spectroscopic studies have shown that this compound has a characteristic absorption band at 1053 nm.</p>Formula:C8H16O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:160.21 g/mol



